DUY NHẤT - MỘT NGÀY 11.11 SALE SÁCH LUYỆN THI - THAM KHẢO 60%
>>> Xem ngay: https://newshop.vn/best-of-best-sale-duy-nhat-1111

Hóa học là một trong những môn học, môn thi làm các sĩ tử phải đau đầu, đứng ngồi không yên. Đừng lo lắng nữa, Newshop mang đến cho bạn đọc bộ đề thi thử THPT Quốc gia 2020 môn Hóa cung cấp cho các bạn nguồn cơ sở tài liệu đáng tin cậy giúp củng cố những kiến thức quan trọng cần thiết, đồng thời bổ sung các kiến thức nâng cao dành cho các bạn muốn "hái" con điểm 9, 10. Bộ đề thi thử chất lượng này sẽ giúp các bạn làm quen với đề thi, rèn luyện kỹ năng làm bài linh hoạt. Cùng tham khảo nhé!!


Xem thêm: 
>>> Đề Thi Thử THPT Quốc Gia 2020 Môn Anh 3 Miền Bắc-Trung-Nam Kèm Lời Giải Chi Tiết
>>> Tổng Hợp ​Đề Thi Thử THPT Quốc Gia 2019 Môn Địa Lí Có Đáp Án Chi Tiết


SỞ GIÁO DỤC & ĐÀO TẠO NINH BÌNH
ĐỀ THI THỬ THPT QUỐC GIA NĂM 2020 LẦN 1
Môn: Hóa học
Thời gian làm bài: 50 phút

Cho  biết nguyên tử khối của các nguyên tố:  H = 1; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; P = 31;    S = 32; Cl = 35,5; K = 39; Ca = 40; Cr = 52; Fe = 56; Cu = 64; Zn = 65; Ag = 108; Ba = 137.

Câu 41. Cách bảo quản thực phẩm (thịt, cá,…) bằng cách nào sau đây được xem là an toàn?
A. Dùng fomon và nước đá khô.                                B. Dùng fomon và phân đạm.
C. Dùng nước đá và nước đá khô.                        D. Dùng phân đạm và nước đá khô.
Câu 42. Khi cho dung dịch anbumin tác dụng với Cu(OH)2 thì thu được dung dịch màu
A. tím.                                B. đỏ.                               C. trắng.                             D. vàng.
Câu 43. Kim loại nào sau đây có khối lượng riêng nhỏ nhất?
A. Al.                                 B. Os.                               C. Mg.                                D. Li.
Câu 44. Kim loại sắt không phản ứng được với dung dịch nào sau đây?
A. H2SO4  loãng, nguội.       B. AgNO3.                        C. FeCl3.                             D. ZnCl2.
Câu 45. Chất hữu cơ X là chất rắn, màu trắng, không tan trong nước, dạng nguyên chất hay gần nguyên chất, được chế thành sơi, tơ, giấy viết. Chất X
A. Saccarozơ.                     B. Tinh bột.                      C. Tristearin.                      D. Xenlulozơ.
Câu 46. Kim loại nào sau đây được điều chế bằng phản ứng thủy luyện?
A. Na.                                B. Mg.                              C. Cu.                                D. Al.
Câu 47. Chất nào sau đây thuộc polisaccarit?
A. tinh bột.                         B. glucozơ.                       C. fructozơ.                        D. saccarozơ.
Câu 48. Chất bột X màu đỏ, được quét lên phía ngoài của vỏ bao diêm. Chất X
A. Kali nitrat.                      B. Photpho.                      C. Lưu huỳnh.                    D. Đá vôi.
Câu 49. Cho hình vẽ bên mô tả thiết bị chưng cất thường. Vai trò của nhiệt kế trong khi chưng cất là
Câu 49 đề thi thử thpt quốc gia 2020 môn hóa sở giáo dục & đào tạo ninh bình
A.  Đo nhiệt độ của ngọn lửa.
B.  Đo nhiệt độ của nước sôi.
C.  Đo nhiệt độ sôi của chất đang chưng cất.
D.  Đo nhiệt độ sôi của hỗn hợp chất trong bình cầu.
Câu 50. Metylamin phản ứng với dung dịch chất nào sau đây?
A. Ca(OH)2.                        B. NH3.                            C. CH3COOH.                    D. NaCl.
Câu 51. Este nào sau đây là no, đơn chức, mạch hở?
A. CH3COOC6H5.               B. HCOOCH=CH2.          C. CH3COOCH3.                D. (HCOO)2C2H4.
Câu 52. Dung dịch chứa chất nào sau đây không làm đổi màu quỳ tím?
A. Axit aminoaxetic.           B. Metylamin.                  C. Axit glutamic.                D. Lysin.
Câu 53. Thí nghiệm nào sau đây xảy ra ăn mòn điện hóa?

  1. Để thanh thép đã được phủ sơn kín trong không khí khô.

  2. Cho lá đồng nguyên chất vào dung dịch gồm Fe(NO3)3 và HNO3.

  3. Cho lá sắt nguyên chất vào dung dịch gồm CuSO4 và H2SO4 loãng.

  4. Nhúng thanh kẽm nguyên chất vào dung dịch HCl.

Câu 54. Loại tơ nào sau đây có nguồn gốc từ xenlulozơ?
A. Tơ visco.                        B. Tơ tằm.                        C. Tơ nilon–6,6.                 D. Tơ olon.
Câu 55. Chất nào sau đây có tính lưỡng tính?
A. Anilin.                            B. Etylamin.                     C. Valin.                             D. Metylamin.
Câu 56. Cho các polime sau: polietilen, poli(vinyl clorua), cao su lưu hóa, nilon–6,6, amilopectin, xenlulozơ. Số polime có cấu trúc mạch không phân nhánh là
A. 3.                                   B. 5.                                 C. 6.                                   D. 4.
Câu 57. Cho các chất sau: phenylamoni clorua, anilin, glyxin, ancol benzylic, metyl axetat. Số chất phản ứng được với dung dịch KOH là
A. 4.                                   B. 1.                                 C. 2.                                   D. 3.
Câu 58. Este X mạch hở có công thức phân tử C5H8O2. Khi đun nóng X với dung dịch NaOH, thu được muối của axit cacboxylic và ancol no. Số đồng phân của X thõa mãn là
A. 6.                                   B. 5.                                 C. 3.                                   D. 4.
Câu 59. Phản ứng nào sau đây là phản ứng trao đổi ion trong dung dịch?
A. Mg + H2SO4 → MgSO4 + H2.                                  B. Fe(NO3)3 + 2KI → Fe(NO3)2 + I2 + 2KNO3.
C. Fe(NO3)3  + 3NaOH → Fe(OH)3 + 3NaNO3.            D. Cu + 2FeCl3 → CuCl2 + 2FeCl2.
Câu 60. Este X mạch hở có công thức phân tử C5H8O4. Xà phòng hóa hoàn toàn X bằng dung dịch NaOH, thu được hai chất hữu cơ Y, Z. Biết Y tác dụng với Cu(OH)2 tạo dung dịch màu xanh lam và Z có khả năng tráng bạc. Phát biểu nào sau đây sai?
A. nZ = 2nY.                                                                 B. Đốt cháy 1 mol Z thu được 0,5 mol CO2.
C. X có khả năng tham gia phản ứng tráng bạc.          D. X có hai công thức cấu tạo phù hợp.
Câu 61. Thủy phân hoàn toàn đisaccarit A thu được hai monosaccarit X Y. Hiđro hóa X hoặc Y đều thu được chất hữu cơ Z. A Z lần lượt là
A. Saccarozơ và glucozơ.                                            B. Glucozơ và sobitol.
C. Tinh bột và glucozơ.       D. Saccarozơ và sobitol.
Câu 62. Cho 1 mol X tác dụng tối đa 1 mol Br2. X là chất nào sau đây?
A. Etilen.                            B. Buta-1,3-đien.             C. Metan.                           D. Axetilen.
Câu 63. Cho các phát biểu sau:

  1. Dầu mỡ sau khi sử dụng, có thể tái chế thành nhiên liệu.

  2. Muối mononatri của axit glutamic được dùng làm bột ngọt (mì chính).

  3. Amilopectin, tơ tằm, lông cừu là polime thiên nhiên.

  4. Chất độn amiăng làm tăng tính chịu nhiệt của chất dẻo.

  5. Khi cho giấm ăn (hoặc chanh) vào sữa bò hoặc sữa đậu nành thì thấy có kết tủa xuất hiện.

  6. Thành phần chính của khi biogas là metan.

Số phát biểu đúng là
A. 5.                                   B. 6.                                 C. 4.                                   D. 3.
Câu 64. Cho 2,52 gam kim loại M tác dụng với dung dịch H2SO4 loãng, vừa đủ, sau phản ứng thu được 6,84 gam muối sunfat trung hòa. Kim loại M

  1. Zn.                                 B. Ca.                               C. Fe.                                 D. Mg.

Câu 65. Thủy phân hợp chất:
NH2-CH(CH3)-CONH-CH2-CONH-CH2-CH2-CONH-CH(C6H5)-CONH-CH(CH3)-COOH
thì số α-amino axit thu được là
A. 4.                                   B. 2.                                 C. 5.                                   D. 3.
Câu 66. Thủy phân 68,4 gam saccarozơ trong môi trường axit với hiệu suất 92%, sau phản ứng thu được dung dịch chứa m gam glucozơ. Giá trị của m là
A. 33,12.                            B. 66,24.                          C. 72,00.                            D. 36,00.
Câu 67. Cho a gam hỗn hợp X gồm glyxin, alanin và valin phản ứng với 100 ml dung dịch HCl 1M thu được dung dịch Y. Để phản ứng hết với các chất trong dung dịch Y cần 380 ml dung dịch KOH 0,5M. Mặt khác, đốt cháy hoàn toàn a gam hỗn hợp X rồi cho sản phẩm cháy vào bình đựng dung dịch Ba(OH)2 dư, sau phản ứng khối lượng dung dịch trong bình giảm 43,74 gam. Giá trị của a là
A. 7,57.                              B. 8,85.                            C. 7,75.                              D. 5,48.
Câu 68. Thuỷ phân hoàn toàn a mol triglixerit X trong dung dịch NaOH vừa đủ, thu được glixerol và m gam hỗn hợp muối . Đốt cháy hoàn toàn a mol X cần vừa đủ 7,75 mol O2 và thu được 5,5 mol CO2. Mặt khác, a mol X tác dụng tối đa với 0,2 mol Br2 trong dung dịch. Giá trị của m là
A. 97,6.                             B. 82,4.                             C. 88,6.                              D. 80,6.
Câu 69. Thực hiện các thí nghiệm sau:

  1. Cu vào dung dịch Fe2(SO4)3.

  2. Sục khí CO2 vào dung dịch Ca(OH)2.

  3. Sục hỗn hợp NO2 và O2 vào nước.

  4. Cho dung dịch HCl vào dung dịch Fe(NO3)2.

  5. Cho FeO vào dung dịch H2SO4 đặc, nóng.

  6. Cho Fe3O4 vào dung dịch HCl.

Số thí nghiệm có xảy ra phản ứng oxi hóa khử là
A. 4.                                  B. 3.                                  C. 2.                                   D. 5.
Câu 70. Rót từ từ dung dịch HCl vào dung dịch hỗn hợp X chứa a mol K2CO3 và 1,25a mol KHCO3 ta có đồ thị như sau:
Câu 70 Đề Thi THPT Quốc Gia 2020 Môn Hóa Sở GD&ĐT Ninh Bình
Khi số mol HCl là x thì dung dịch chứa 97,02 gam chất tan. Giá trị của a là
A. 0,24.                             B. 0,36.                             C. 0,18.                              D. 0,20.
Câu 71. Cho các phát biểu sau:

  1. Thủy phân tripanmitin và etyl axetat đều thu được ancol.

  2. Mỡ động vật và dầu thực vật đều chứa nhiều chất béo.

  3. Hiđro hóa triolein thu được tripanmitin.

  4. Thủy phân vinyl fomat thu được hai sản phẩm đều có phản ứng tráng bạc.

  5. Ứng với công thức đơn giản nhất là CH2O có 3 chất hữu cơ đơn chức, mạch hở.

Số phát biểu đúng là
A. 2.                                  B. 4.                                  C. 3.                                   D. 5.
Câu 72. Cho các bước tiến hành thí nghiệm tráng bạc của glucozơ:

  1. Thêm 3 - 5 giọt glucozơ vào ống nghiệm.

  2. Nhỏ từ từ dung dịch NH3 cho đến khi kết tủa tan hết.

  3. Đun nóng nhẹ hỗn hợp ở 60 - 70°C trong vài phút.

  4. Cho 1 ml dung dịch AgNO3 1% vào ống nghiệm sạch.

Thứ tự tiến hành đúng là
A. 4, 2, 1, 3.                      B. 1, 4, 2, 3.                     C. 1, 2, 3, 4.                       D. 4, 2, 3, 1.
Câu 73. Hỗn hợp X gồm Al, Fe2O3, Fe3O4, CuO (trong đó oxi chiếm 25,39% về khối lượng hỗn hợp). Cho m gam hỗn hợp X tác dụng với 8,96 lít khí CO (ở đktc) sau một thời gian thu được hỗn hợp rắn Y và hỗn hợp khí Z có tỉ khối so với hiđro là 19. Cho hỗn hợp Y tác dụng với dung dịch HNO3 loãng dư thu được dung dịch T và 7,168 lít khí NO (ở đktc, sản phẩm khử duy nhất). Cô cạn T thu được 3,456m gam muối khan. Giá trị của m gần nhất với giá trị nào sau đây?
A. 38,43.                            B. 35,19.                          C. 41,13.                            D. 40,43.
Câu 74. Đốt cháy hoàn toàn 0,6 mol hỗn hợp E chứa ancol X, este đơn chức Y và andehit Z (X, Y, Z đều no, mạch hở và có cùng số nguyên tử hidro) có tỉ lệ mol tương ứng 3 : 1 : 2 thu được 24,64 lít CO2 (đktc) và 21,6 gam nước. Mặt khác, cho 0,6 mol hỗn hợp E trên tác dụng với dung dịch AgNO3 trong NH3 đun nóng thu được m gam Ag. Giá trị m của là
A. 97,2.                             B. 64,8.                             C. 108.                               D. 86,4.
Câu 75. Cho hỗn hợp E gồm X (C6H16O4N2) và Y (C9H23O6N3, là muối của axit glutamic) tác dụng hoàn toàn với dung dịch KOH thu được 7,392 lít hỗn hợp hai amin no (kế tiếp trong dãy đồng đẳng, có tỷ khối so với H2 là 107/6) và dung dịch T. Cô cạn T, thu được m gam hỗn hợp G gồm ba muối khan trong đó có 2 muối có cùng số nguyên tử cacbon trong phân tử. Giá trị của m là
A. 55,44.                            B. 93,83.                          C. 51,48.                            D. 58,52.
Câu 76. Điện phân dung dịch X chứa Cu(NO3)2 và NaCl với điện cực trơ thấy thể tích khí thoát ra ở cả 2 điện cực (V lít) và thời gian điện phân (t giây) phụ thuộc nhau như trên đồ thị bên.
Câu 76 Đề Thi Thử THPT Quốc Gia 2020 Môn Hóa Sở GD&ĐT Ninh Bình
Nếu điện phân dung dịch trong thời gian 2,5a giây rồi cho dung dịch sau điện phân tác dụng với lượng Fe dư (NO là sản phẩm khử duy nhất của N+5) thì lượng Fe tối đa đã phản ứng là
A. 7,0.                                B. 4,2.
C. 6,3.                                D. 9,1.
Câu 77. Đốt cháy hoàn toàn m gam hỗn hợp A gồm 3 este X, Y, Z (đều mạch hở và chỉ chứa chức este, Z chiếm phần trăm khối lượng lớn nhất trong P) thu được lượng CO2 lớn hơn H2O là 0,25 mol. Mặt khác, m gam P phản ứng vừa đủ với dung dịch NaOH thu được 22,2 gam 2 ancol hơn kém nhau 1 nguyên tử cacbon và hỗn hợp T gồm 2 muối. Đốt cháy hoàn toàn T cần vừa đủ 0,275 mol O2 thu được CO2, 0,35 mol Na2CO3 và 0,2 mol H2O. Phần trăm khối lượng của Z trong A
A. 45,20%.                        B. 50,40%.                       C. 62,10%.                         D. 42,65%.
Câu 78. X Y là hai axit cacboxylic đơn chức (trong đó có một axit có một liên kết đôi C=C, MX < MY), Z là este đơn chức, T là este 2 chức (các chất đều mạch hở, phân tử không có nhóm chức nào khác, không có khả năng tráng bạc). Cho 38,5 gam hỗn hợp E gồm X, Y, Z, T tác dụng vừa đủ với 470 ml dung dịch NaOH 1M được m gam hỗn hợp 2 muối và 13,9 gam hỗn hợp 2 ancol no, mạch hở có cùng số nguyên tử C trong phân tử. Đốt cháy hoàn toàn m gam hỗn hợp muối cần vừa đủ 27,776 lít O2 thu được Na2CO3 và 56,91 gam hỗn hợp gồm CO2 và H2O. Phần trăm theo khối lượng của T trong E gần nhất với giá trị nào sau đây?
A. 41.                                 B. 66.                               C. 26.                                 D. 61.

Câu 79. Hòa tan hoàn toàn 8,6 gam hỗn hợp Al, Mg, Fe, Zn vào 100 gam dung dịch gồm KNO3 1M và H2SO4 2M, thu được dung dịch X chứa 43,25 gam muối trung hòa (không chứa Fe3+) và hỗn hợp khí Y (trong đó H2 chiếm 4% khối lượng Y). Cho một lượng KOH vào X, thu được dung dịch chỉ chứa một chất tan và kết tủa Z (không có khí thoát ra). Nung Z trong không khí đến khối lượng không đổi được 12,6 gam chất rắn. Nồng độ phần trăm của FeSO4 trong X gần giá trị nào nhất sau đây?
A. 7,00%.        B. 7,50%.        C. 7,25%.        D. 7,75%.

Câu 80. Thực hiện thí nghiệm theo thứ tự sau:
- Cho vài giọt phenolphtalein vào 3 ống nghiệm chứa nước được đánh số thứ tự 1, 2, 3.
- Cho vào ống nghiệm thứ nhất 1 mẩu Na (nhỏ bằng hạt gạo).
- Cho vào ống nghiệm thứ hai 1 mẩu Mg.
- Cho vào ống nghiệm thứ ba một mẩu nhôm (đã được đánh sạch).
Để yên một thời gian rồi lần lượt đun nóng các ống nghiệm. Phát biểu nào sau đây là đúng?
  1. Sau khi đun nóng, có 2 ống nghiệm chuyển sang màu hồng.
  2. Chỉ có ống nghiệm thứ nhất dung dịch có màu hồng sau khi đun nóng.
  3. Trước khi đun nóng, không có ống nghiệm nào có màu hồng.
  4. Ống nghiệm thứ 3 trước khi đun nóng không có hiện tượng gì, sau khi đun nóng dung dịch chuyển màu hồng.
Đáp Án Đề Thi Thử THPT Quốc Gia 2020 Môn Hóa Sở GD&ĐT Ninh Bình
Đáp Án Đề Thi Thử THPT Quốc Gia 2020 Môn Hóa Sở GD&ĐT Ninh Bình
Đáp Án Đề Thi Thử THPT Quốc Gia 2020 Môn Hóa Sở GD&ĐT Ninh Bình

TRƯỜNG THPT CHUYÊN VINH - NGHỆ AN

ĐỀ THI THỬ THPT QUỐC GIA NĂM 2020 LẦN 3
Môn: Hóa học
Thời gian làm bài: 50 phút

Cho biết nguyên tử khối của các nguyên tố: H = 1; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; P = 31; S = 32; Cl = 35,5; K = 39; Ca = 40; Cr = 52; Fe = 56; Cu = 64; Zn = 65; Ag = 108; Ba = 137.
Câu 41. Từ thời thượng cổ con người đã biết sơ chế các hợp chất hữu cơ. Cách làm nào sau đây là phương pháp kết tinh?
     A. Làm đường cát, đường phèn từ mía.
     B. Giã cây chàm, cho vào nước, lọc lấy dung dịch màu để nhuộm sợi, vải.
     C. Nấu rượu để uống.
     D. Ngâm rượu thuốc.
Câu 42. Chất nào sau đây khi cho tác dụng với H2SO4 đặc, nóng không có khí thoát ra?
     A. FeO. B. Fe(OH)2.           C. Fe2O3. D. Fe3O4.
Câu 43. Cho 16 gam Fe2O3 phản ứng vừa đủ với V ml dung dịch HCl 1M. Giá trị của V là
     A. 400. B. 300.                   C. 200.                D. 600.
Câu 44. Chất nào sau đây làm đổi màu quỳ tím?
     A. Lysin. B. Glyxin. C. Alanin. D. Valin.
Câu 45. Trong máu người luôn có nồng độ gluxit X không đổi là 0,1%. Nếu lượng X trong máu giảm đi thì người đó mắc bệnh suy nhược. Ngược lại nếu lượng X trong máu tăng lên thì đó là người mắc bệnh tiểu đường hay đường huyết. Chất X là
     A. Glucozơ. B. Amilozơ. C. Saccarozơ. D. Fructozơ.
Câu 46. Môi trường không khí, đất, nước xung quanh các nhà máy hóa chất thường bị ô nhiễm nặng bởi khí độc, ion kim loại nặng và các hóa chất. Biện pháp nào sau đây không thể chống ô nhiễm môi trường?
     A. Sử dụng công nghệ sản xuất hiện đai, nhiên liệu sạch.
     B. Xả chất thải trực tiếp ra môi trường.
     C. Thực hiện chu trình khép kín để tận dụng chất thải một cách hiệu quả.
     D. Có hệ thống xử lí chất thải hợp lí trước khi xả thải ra môi trường.
Câu 47. Trong các kim loại sau, kim loại nào không phải là kim loại kiềm thổ?
      A. Ca. B. Be. C. Mg. D. Na.
Câu 48. Cho các chất sau: Fe(NO3)3, FeCl2, NaHCO3, Al(OH)3. Có bao nhiêu chất tác dụng với dung dịch HCl?
      A. 1. B. 4. C. 3. D. 2.
Câu 49. Polime nào sau đây có cấu trúc mạch phân nhánh?
      A. Xenlulozơ. B. Polietilen. C. Amilopectin. D. Amilozơ.
Câu 50. Khi cho chất X vào dung dịch kiềm, lúc đầu thu được kết tủa màu trắng hơi xanh, sau đó chuyển dần sang nâu đỏ khi đưa ra ngoài không khí. Chất X là
      A. FeSO4. B. AlCl3. C. MgSO4. D. CuSO4.
Câu 51. Kali nitrat được dùng làm phân bón và chế tạo thuốc nổ. Công thức của kali nitrat là?
      A. KHCO3. B. KNO2. C. K3PO4. D. KNO3.
Câu 52: Trong công nghiệp kim loại Cr được điều chế bằng phương pháp nào sau đây?
      A. Thủy luyện. B. Nhiệt nhôm.
      C. Điện phân dung dịch. D. Điện phân nóng chảy.
Câu 53. Benzyl axetat có mùi thơm của hoa nhài. Công thức phân tử của benzyl axetat là
      A. C9H8O2. B. C9H10O2. C. C8H10O2. D. C9H10O4.
Câu 54. Chất có khả năng tham gia phản ứng cộng với H2 (xúc tác Ni, đun nóng) là
      A. C2H5OH. B. CH3NH2.              C. CH3COOC2H3. D. CH3COOH.
Câu 55. Xà phòng hóa este X hai chức có công thức phân tử C5H8O4 thu được sản phẩm có khả năng hòa tan Cu(OH)2 tạo dung dịch xanh lam. Số công thức cấu tạo phù hợp của X là
      A. 4. B. 3. C. 1. D. 2.
Câu 56. Nhóm các vật liệu được chế tạo từ polime trùng ngưng là
      A. Cao su, tơ tằm, tơ lapsan. B. Thủy tinh plexiglas, nilon-6,6, tơ nitron.
      C. Nilon-6,6, nilon-6, tơ lapsan. D. Tơ visco, nilon-6, nilon-6,6.
Câu 57. Đốt cháy hoàn toàn một amino axit X (phân tử có 1 nhóm NH2) thu được 8,8 gam CO2 và 1,12 lít N2. Công thức phân tử của X là
     A. C3H7NO2. B. C4H9NO2. C. C2H7NO2. D. C2H5NO2.
Câu 58. Cho m gam hỗn hợp gồm axit axetic, axit oxalic, axit glutamic tác dụng vừa đủ với V ml dung dịch NaOH 1M thu được dung dịch chứa (m + 8,8) gam muối. Giá trị của V là
     A. 200. B. 400. C. 250. D. 300.
Câu 59. Xenlulozơ trinitrat được điều chế từ xenlulozơ và axit nitric đặc có xúc tác là axit sunfuric đặc, đun nóng. Để có 59,4 kg xenlulozơ trinitrat cần dung dịch chứa m kg axit nitric (hiệu suất 90%). Giá trị của m là
     A. 42,0. B. 30,0. C. 14,0. D. 37,8.
Câu 60. Cho hình vẽ mô tả thí nghiệm điều chế khí Y từ dung dịch chứa chất X:
Câu 60 Đề Thi THPT Quốc Gia 2020 Môn Hóa Trường THPT Chuyên Vinh - Nghệ An
Cặp chất X, Y phù hợp là
  1. Cu(NO3)2 và NO2.
  2. NH4NO2 và N2.
  3. CH3COONa và CH4.
  4. KClO3 và Cl2.
Câu 61. Cho 12 gam Fe vào 100 ml dung dịch chứa CuSO4 1M và Fe2(SO4)3 1M. Sau khi các phản ứng xảy ra hoàn toàn thu được m gam chất rắn. Giá trị của m là
A. 12,8.                              B. 9,2.                              C. 7,2.                                D. 6,4.
Câu 62. Nhận xét nào sau đây là sai?
  1. Để gang hoặc thép trong không khí ẩm sẽ xảy ra hiện tượng ăn mòn điện hóa học.
  2. Trong ăn mòn hóa học, electron của kim loại được chuyển trục tiếp đến các chất trong môi trường.
  3. Để bảo vệ vỏ tàu biển làm bằng thép, người ta gắn vào mặt ngoài của vỏ tàu (phần chìm dưới nước) những lá Zn - đây là cách chống ăn mòn kim loại bằng phương pháp bảo vệ bề mặt.
  4. Trong tự nhiên, sự ăn mòn kim loại xảy ra phức tạp, có thể xảy ra đồng thời quá trình ăn mòn điện hóa học và ăn mòn hóa học.
Câu 63. Đốt cháy hoàn toàn este X thu được CO2 và H2O có số mol bằng nhau, X có thể là este
A. no, mạch hở, đơn chức.                                          B. no, ba chức.
C. no, mạch hở, hai chức.                                           D. không no, mạch hở, đơn chức.
Câu 64. Phản ứng nào sau đây không phải là phản ứng trao đổi?
  1. FeCO3 + 2HCl → FeCl2 + CO2 + H2O.
  2. NH4Cl + NaOH → NaCl + NH3 + H2O.
  3. Na2SO4 + BaCl2 → BaSO4 + 2NaCl.
  4. 2FeCO3 + 4H2SO4 → Fe2(SO4)3 + SO2 + 2CO2 + 4H2O.
Câu 65: Cho các thí nghiệm sau:
  1. Cho hỗn hợp gồm x mol Cu và x mol Fe3O4 vào dung dịch chứa 4x mol H2SO4 loãng.
  2. Cho hỗn hợp NaHSO4 và KHCO3 (tỉ lệ mol 1 : 1) vào nước dư.
  3. Cho x mol Fe vào dung dịch chứa 2,5x mol AgNO3.
  4. Cho dung dịch chứa x mol Ba(OH)2 vào dung dịch chứa x mol NaHCO3.
  5. Cho Na2CO3 dư vào dung dịch chứa BaCl2.
  6. Cho x mol Fe3O4 vào dung dịch chứa 8x mol HCl.
Sau khi các phản ứng kết thúc mà sau thí nghiệm thu được dung dịch chứa 2 muối  là
A. 4.                                   B. 6.                                 C. 5.                                   D. 3.
Câu 66: Hấp thụ hết 0,2 mol khí CO2 vào dung dịch chứa x mol NaOH và y mol Na2CO3 thu được 100 ml dung dịch X. Lấy 50 ml dung dịch X tác dụng với dung dịch Ca(OH)2 dư thu được 20 gam kết tủa. Mặt khác, khi lấy 50 ml dung dịch X cho từ từ vào 150 ml dung dịch HCl 1M thu được 0,12 mol khí CO2. Biết các phản ứng xảy ra hoàn toàn. Giá trị của x và y lần lượt là
A. 0,1 và 0,45                    B. 0,14 và 0,2.                 C. 0,12 và 0,3.                   D. 0,1 và 0,2.
Câu 67: Hỗn hợp X gồm các triglixerit trong phân tử đều chứa axit stearic, axit oleic, axit linoleic. Đốt cháy hoàn toàn m gam X cần a mol O2 thu được 0,285 mol CO2. Xà phòng hóa hoàn toàn m gam X bằng dung dịch NaOH vừa đủ được m1 gam muối. Giá trị a và m1 lần lượt là
A. 0,8 và 8,82.                   B. 0,4 và 4,32.                 C. 0,4 và 4,56.                   D. 0,75 và 5,62.
Câu 68: Bảng dưới đây ghi lại hiện tượng phản ứng khi làm thí nghiệm với các chất sau ở dạng dung dịch nước: X, Y, Z, T.
Chất
Thuốc thử
X Y Z T
Dung dịch AgNO3/NH3 đun nóng nhẹ không có kết tủa Ag↓ không có kết tủa không có kết tủa
 
Cu(OH)2, lắc nhẹ
Cu(OH)2
không tan
Cu(OH)2
không tan
dung dịch có màu
xanh lam
Cu(OH)2
không tan
Nước brom có kết tủa không có kết tủa không có kết tủa không có kết tủa
Các chất X, Y, Z, T lần lượt là
A. phenol, anđehit fomic, glixerol, etanol.                  B. anilin, gilxerol, anđehit fomic, metyl fomat
C. phenol, axetanđehit, etanol, anđehit fomic            D. glixerol, etylen glicol, metanol, axetanđehit.
Câu 69: Cho 14,6 gam Gly-Ala tác dụng hết với dung dịch HCl dư được dung dịch X. Cô cạn dung dịch X được bao nhiêu gam muối khan?
A. 23,7 gam.                      B. 28,6 gam.                    C. 19,8 gam.                       D. 21,9 gam.
Câu 70: Cho các phát biểu sau:
  1. Este có nhiệt độ sôi thấp hơn so với axit và ancol có cùng số nguyên tử cacbon.
  2. Dầu ăn và mỡ bôi trơn có cùng thành phần nguyên tố.
  3. Tên thay thế của amin có công thức (CH3)3N là trimetylamin
  4. Dung dịch 37 - 40% fomanđehit trong nước gọi là fomalin (còn gọi là fomon) được dùng để ngâm xác động vật, thuộc da, tẩy uế, diệt trùng.
  5. Các chất: cocain, amphetamin, heroin, moocphin là những chất gây nghiện, hết sức nguy hại cho sức khỏe con người.
Có bao nhiêu phát biểu sai?
A. 3.                                   B. 1.                                 C. 4.                                   D. 2.

Câu 71: Đốt cháy hoàn toàn 0,2 mol hỗn hợp X gồm metan, axetilen, buta-1,3-đien và vinyl axetilen thu được 24,2 gam CO2 và 7,2 gam nước. Biết a mol hỗn hợp X làm mất màu tối đa 112 gam Br2 trong dung dịch. Giá trị của a là
A. 0,2.                                B. 0,4.                              C. 0,1.                                D. 0,3.
Câu 72: Cho 200 ml dung dịch NaOH 3M vào 100ml dung dịch AlCl3 1M thu được dung dịch X. Nhỏ từ từ đến hết V ml dung dịch HCl 1M vào dung dịch X thu được 5,85 gam kết tủa. Biết các phản ứng xảy ra hoàn toàn. Giá trị lớn nhất của V là
A. 175.                               B. 425.                             C. 375.                               D. 275.
Câu 73: Hòa tan hoàn toàn 2 chất rắn X, Y (có số mol bằng nhau) vào nước thu được dung dịch Z. Tiến hành các thí nghiệm sau:
Thí nghiệm 1: Cho dung dịch NH3 dư vào dung dịch Z thu được x1 mol kết tủa.
Thí nghiệm 2: Cho dung dịch Na2CO3 dư vào dung dịch Z thu được x2 mol kết tủa. Thí nghiệm 3: Cho dung dịch Ba(OH)2 dư vào dung dịch Z thu được x3 mol kết tủa.
Biết các phản ứng xảy ra hoàn toàn và x1 < x2 < x3. Hai chất X, Y lần lượt là

A. BaCl2 và FeCl2.               B. FeSO4 và Fe2(SO4)3.      C. AlCl3 và FeCl3.               D. ZnSO4 và Al2(SO4)3.
Câu 74: Cho 0,2 mol hỗn hợp gồm X (C3H10O2N2) và Y (C4H12O4N2) tác dụng vừa đủ với 300 ml dung dịch NaOH 1M thu được amin Z có tỉ khối so với H2 bằng 15,5 và dung dịch T. Cô cạn dung dịch T thu được hỗn hợp G gồm 2 muối có số nguyên tử C bằng nhau. Phần trăm khối lượng của muối có phân tử khối lớn hơn trong G có giá trị gần nhất với giá trị nào sau đây?
A. 64.                                 B. 42.                               C. 58.                                 D. 35.
Câu 75: Cho từ từ dung dịch HCl loãng vào dung dịch chứa NaOH và NaAlO2 (hay Na[Al(OH)4]. Sự phụ thuộc của số mol kết tủa thu được vào số mol HCl được biểu diễn theo đồ thị sau:
Câu 75 Đề Thi THPT Quốc Gia 2020 Môn Hóa Trường THPT CHuyên Vinh - Nghệ An
Tổng giá trị (x + y) là
A. 3,5.                                B. 3,8.                              C. 3,1.                                D. 2,2.
Câu 76: Hòa tan hoàn toàn 20,7 gam hỗn hợp X gồm Na, Ba, Na2O và BaO vào nước thu được 4 lít dung dịch Y có pH = 13 và 0,05 mol khí H2. Cho 4 lít dung dịch Y tác dụng với 100ml dung dịch chứa H2SO4 0,3M và Al2(SO4)3 0,5M. Sau khi các phản ứng xảy ra hoàn toàn thu được m gam kết tủa. Giá trị của m gần nhất với giá trị nào sau đây?
A. 35.                                 B. 42.                               C. 30.                                 D. 25.
Câu 77: Hòa tan hoàn toàn m gam hỗn hợp gồm CuSO4 và FeCl3 vào nước thu được dung dịch X. Điện phân dung dịch X (với các điện cực trở) đến khi ở anot thoát ra 0,2 mol hỗn hợp khí có tỉ khối so với H2 bằng 30,625 thì dừng lại. Dung dịch thu được sau điện phân có chứa 2 muối có nồng độ mol bằng nhau. Giả sử hiệu suất điện phân là 100% khí sinh ra không tan trong nước. Giá trị của m là
A. 48,25.                            B. 64,25.                          C. 62,25.                            D. 56,25.
Câu 78: Hỗn hợp M gồm hai axit cacboxylic no, mạch hở (phân tử chỉ chứa nhóm –COOH) và một ancol no, mạch hở. Đốt cháy hoàn toàn m gam M, thu được CO2 và 10,8 gam H2O. Nếu đun nóng m gam M trên (có H2SO4 đặc làm xúc tác) thì các chất trong hỗn hợp phản ứng vừa đủ với nhau chỉ tạo thành H2O và este X (phân tử chỉ chứa chức este, giả thiết phản ứng este hóa đạt hiệu suất 100%). Để đốt cháy hoàn toàn 
lượng X sinh ra cần dùng vừa đủ 0,5625 mol O2 thu được hỗn hợp CO2 và H2O thỏa mãn điều kiện 3n(X phản ứng)=n(CO2) - n(H2O)
Công thức phân tử của X
A. C8H10O6.                        B. C8H8O4.                       C. C7H8O6.                         D. C7H6O6.
Câu 79: Chia hỗn hợp X gồm Fe, Fe3O4, Fe(OH)3 và FeCO3 thành hai phần bằng nhau. Hòa tan hoàn toàn một phần trong dung dịch HCl dư, thu được 0,1 mol hỗn hợp hai khí có tỉ khối so với H2 bằng 9,4 và dung dịch Y. Cho hai phần tác dụng với lượng dư dung dịch H2SO4 đặc, nóng. Sau khi các phản ứng xảy ra hoàn toàn, thu được dung dịch Z và 0,2075 mol hỗn hợp khí T gồm CO2 và SO2 (sản phẩm khử duy nhất của S+6). Khối lượng của FeCl2 có trong dung dịch Y
A. 25,307 gam.                   B. 27,305 gam.                 C. 23,705 gam.                   D. 25,075 gam.
Câu 80: Hỗn hợp E gồm axit no, đơn chức X, axit đa chức Y (phân tử có ba liên kết π, mạch không phân nhánh) đều mạch hở và este Z (chỉ chứa nhóm chức este) tạo bởi ancol đa chức T với X Y. Đốt cháy hoàn toàn 14,93 gam E cần dùng vừa đủ 0,3825 mol O2. Mặt khác, 14,93 gam E phản ứng tối đa với 260ml dung dịch NaOH 1M thu được m gam ancol T. Đốt cháy hoàn toàn m gam ancol T thu được 1,98 gam CO2 và 1,08 gam H2O. Nhận xét nào sau đây là sai?
  1. Z có hai công thức cấu tạo phù hợp.
  2. Có thể dùng nước brom để nhận biết X, Y, T.
  3. Tổng số nguyên tử hidro trong phân tử Z là 10.
  4. Y có đồng phân hình học cis – trans.
Đáp Án Đề Thi Thử THPT Quốc Gia 2020 Trường THPT Chuyên Vinh - Nghệ An
Đáp Án Đề Thi Thử THPT Quốc Gia 2020 Trường THPT Chuyên Vinh - Nghệ An
Đáp Án Đề Thi Thử THPT Quốc Gia 2020 Trường THPT Chuyên Vinh - Nghệ An

TRƯỜNG THPT LƯƠNG THẾ VINH - HÀ NỘI
ĐỀ THI THỬ THPT QUỐC GIA NĂM 2020 LẦN 2
Môn: Hóa học
Thời gian làm bài: 50 phút

Cho biết nguyên tử khối của các nguyên tố: H = 1; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; P = 31; S = 32; Cl = 35,5; K = 39; Ca = 40; Cr = 52; Fe = 56; Cu = 64; Zn = 65; Ag = 108; Ba = 137.
Câu 1: Cho 12,5 gam hỗn hợp gồm Al, Fe và Zn tác dụng hết với dung dịch H2SO4 loãng dư thu được m gam muối và 4,48 lít khí ở đktc. Giá trị của m là
A. 45,6 gam.                       B. 27,8 gam.                     C. 31,7 gam.                       D. 36,4 gam.
Câu 2: Cho 2,7 gam Al vào dung dịch KOH dư thu được tối đa V lít khí ở đktc. Giá trị của V là
A. 5,6 lít.                             B. 3,36 lít.                         C. 4,48 lít.                           D. 2,24 lít.
Câu 3: Có các thí nghiệm sau:
  1. Dẫn khí NH3 vào dung dịch AlCl3.
  2. Dẫn khí etilen vào dung dịch thuốc tím.
  3. Trộn lẫn dung dịch NaOH với dung dịch Ca(HCO3)2.
  4. Dẫn khí CO2 cho tới dư vào dung dịch Ba(OH)2.
  5. Dẫn khí SO2 vào dung dịch H2S.
  6. Cho mẩu K (dư) vào dung dịch ZnCl2.
  7. Cho axit photphoric vào dung dịch nước vôi trong dư.
Có bao nhiêu thí nghiệm thu được kết tủa khi kết thúc các phản ứng?
A. 5.                                   B. 4.                                 C. 3.                                   D. 6.
Câu 4: Amin nào sau đây là amin bậc 2?
A. anilin.                             B. iso-propyl amin.          C. n-propyl amin.               D. đimetyl amin.
Câu 5: Đun nóng dung dịch chứa 9 gam glucozơ với AgNO3 trong NH3 dư thu được tối đa m gam Ag. Giá trị của m là
A. 5,4.                                B. 32,4.                            C. 21,6.                              D. 10,8.
Câu 6: Hợp chất nào sau đây của lưu huỳnh có tính tẩy màu?
A. H2S.                               B. SO2.                             C. SO3.                               D. H2SO4.
Câu 7: Dung dịch nào sau đây dẫn được điện?
A. Dung dịch H2SO4.          B. Dung dịch etanol.        C. Dung dịch glucozơ.        D. Dung dịch saccarozơ.
Câu 8: Sắp sếp các chất sau: (1) NH3; (2) KOH; (3) CH3NH2; (4) anilin, theo thứ tự tính bazơ tăng dần?
A. (4), (3), (2), (1).             B. (3), (2), (1), (4).           C. (1), (2), (3), (4).             D. (4), (1), (3), (2).
Câu 9: Tính chất nào sau đây không phải của etanal?
A. tác dụng với H2.                                                     B. tác dụng với dung dịch AgNO3/NH3.
C. tác dụng với dung dịch NaCl.                                D. tác dụng với nước brom.
Câu 10: Chất nào sau đây là đisaccarit?
A. Saccarozơ.                     B. Tinh bột.                      C. Fructozơ.                       D. Glucozơ.
Câu 11: Cho 14,7 gam axit glutamic tác dụng vừa đủ với dung dịch NaOH tạo thành m gam muối. Giá trị của m là
A. 16,9 gam.                       B. 19,1 gam.                    C. 23,5 gam.                       D. 18,6 gam.
Câu 12: Phản ứng nào sau đây không đúng?
A. 2Cr3+ + Zn ® 2Cr2+ + Zn2+.
B. 2Cr3+ + 3Br2 + 16OH- ® 2CrO42- + 6Br- + 8H2O.
C. 2CrO2- + 3Br2 + 8OH- ® 2CrO42- + 6Br- + 4H2O.
D. 2Cr3+ + 3Fe ® 2Cr + 3Fe2+.
Câu 13: Quặng nào sau đây có chứa nguyên tố nhôm?
A. Manhetit.                       B. Đôlômit.                      C. Boxit.                             D. Xinvinit.
Câu 14: Kim loại sắt không tan trong dung dịch nào sau đây?
A. H2SO4  đặc, nguội.          B. HCl.                             C. FeCl3.                             D. H2SO4 loãng.
Câu 15: Metanol là một độc tố ngây chết người hàng đầu trong các vụ ngộ độc rượu. Công thức phân tử của metanol là
A. HCHO.                          B. C6H5OH.                      C. CH3OH.                         D. C6H5CH2OH.
Câu 16: Khi đốt cháy các hợp chất của natri trên ngọn lửa đèn khí ta sẽ thấy ngọn lửa có màu nào sau đây?
A. Tím.                               B. Đỏ.                              C. Vàng.                             D. Xanh.
Câu 17: Hỗn hợp M gồm aminoaxit: H2NR(COOH)x và axit: CnH2n+1COOH. Đốt cháy hoàn toàn 0,25 mol M thu được 13,44 lít CO2 (đktc) và 12,15 gam H2O. Mặt khác, cho 0,2 mol M phản ứng vừa đủ với dung dịch chứa a mol HCl. Giá trị của a là
A. 0,16.                              B. 0,12.                            C. 0,14.                              D. 0,1.
Câu 18: Khi cho các hợp kim sau đây vào dung dịch NaCl. Trường hợp nào sắt bị phá hủy trước?
A. Cr-Fe.                            B. Fe-Cu.                         C. Al-Fe.                            D. Zn-Fe.
Câu 19: Chất nào sau đây không tan trong nước?
A. etyl axetat.                     B. axit axetic.                   C. glyxin.                           D. etanol.
Câu 20: Polime nào sau đây mà trong phân tử có chứa 3 nguyên tố?
A. PVA.                              B. PP.                               C. PE.                                 D. Cao su Buna.
Câu 21: Trong số các polime sau: amilozơ, tơ nilon-6, xenlulozơ, tơ tằm, tơ visco, cao su Buna-S, polietilen. Có bao nhiêu polime là polime thiên nhiên?
A. 3.                                   B. 5.                                 C. 6.                                   D. 4.
Câu 22: Axit axetic không tác dụng với chất nào sau đây?
A. KCl.                               B. etanol.                         C. CaCO3.                          D. CuO.
Câu 23: Có các phát biểu sau:
  1. Mọi este khi xà phòng hóa đều tạo ra muối và ancol.
  2. Phản ứng tổng hợp este xảy ra chậm và thuận nghịch.
  3. Amilopectin, tơ tằm, lông cừu là polime thiên nhiên.
  4. Cao su Buna–S được điều chế bằng phản ứng trùng ngưng.
  5. H2SO4 đặc chỉ đóng vai trò chất hút nước trong phản ứng tổng hợp este.
  6. Tinh bột và xenlulozơ là đồng phân của nhau.
  7. Protein dạng sợi dễ dàng tan vào nước tạo thành dung dịch keo.
  8. Amilozơ và amilopectin đều có các liên kết α-1,4-glicozit. Số phát biểu sai
A. 7.                                   B. 6.                                 C. 5.                                   D. 4.
Câu 24: Nung hoàn toàn m gam Cu(NO3)2 thu được hỗn hợp khí NO2 và O2. Hấp thụ hoàn toàn lượng  khí đó bằng nước thu được 2 lít dung dịch có pH = 1,0. Tính m.
A. 15,04 gam.                     B. 18,8 gam.                     C. 14,1 gam.                      D. 9,4 gam.
Câu 25: Chọn câu sai?
  1. Hỗn hợp Fe3O4 và Cu có thể tan hết trong dung dịch HCl.
  2. Hỗn hợp CuS và FeS có thể tan hết trong dung dịch HCl.
  3. Hỗn hợp Al và BaO có thể tan hết trong nước.
  4. Hỗn hợp Al2O3 và K2O có thể tan hết trong nước.
Câu 26: Có các phát biểu sau:
  1. Tất cả ancol đa chức đều có khả năng tạo phức với Cu(OH)2.
  2. Đốt cháy ancol no, đơn chức X luôn sinh ra số mol nước nhiều hơn số mol CO2.
  3. Tất cả ancol no, đơn chức, mạch hở đều có khả năng tách nước tạo thành olefin.
  4. Oxi hóa ancol đơn chức X cho sản phẩm hữu cơ Y, nếu Y tráng gương thì X là ancol bậc 1.
  5. Phenol là những hợp chất hữu cơ có nhóm -OH liên kết trực tiếp với nguyên tử cacbon của vòng benzen.
  6. Dung dịch phenol (C6H5OH) không làm đổi màu quỳ tím.
Số phát biểu đúng là
A. 3.                                   B. 4.                                 C. 5.                                   D. 6.
Câu 27: Từ tinh bột điều chế cao su buna theo sơ đồ sau:
Tinh bột → glucozơ → ancol etylic → but-1,3-đien → cao su buna
Hiệu suất của quá trình điều chế là 75%, muốn thu được 32,4 kg cao su buna thì khối lượng tinh bột cần dùng là
A. 96,4 kg.                         B. 129,6 kg.                     C. 108,8 kg.                       D. 181,2 kg.
Câu 28: Có các phát biểu sau:
  1. Trong công nghiệp N2 được điều chế bằng cách chưng cất phân đoạn không khí lỏng.
  2. Nhiệt phân NH4NO3 tạo thành NH3 và HNO3.
  3. Chất lượng phân kali được đánh giá thông qua phần trăm theo khối lượng của kali.
  4. Tính oxi hóa mạnh của HNO3 là do ion H+ gây ra.
  5. CO, N2O, NO là oxit axit.
  6. Trong khí than ướt và khí than khô đều có chứa CO. Số phát biểu sai
A. 4.                                   B. 2.                                 C. 3.                                   D. 5.
Câu 29: Phát biểu nào sau đây sai?
  1. Polipeptit kém bền trong môi trường axit và môi trường bazơ.
  2. Glyxin, alanin, anilin không làm đổi màu quì tím.
  3. Metylamin tan trong nước tạo dung dịch có môi trường bazơ.
  4. Peptit Gly-Ala tác dụng với Cu(OH)2 tạo hợp chất màu tím.
Câu 30: Cho các phát biểu sau:
  1. Có thể phân biệt eten và etanal bằng dung dịch nước brom.
  2. Tất cả andehit khi tráng gương chỉ cho một kết tủa duy nhất (Ag).
  3. Andehit vừa có tính oxi hóa vừa có tính khử.
  4. Những phản ứng của các hợp chất hữu cơ với AgNO3/NH3 đều gọi là phản ứng tráng gương.
  5. Có thể phân biệt HCOOH và CH2=CH-COOH bằng dung dịch nước brom.
  6. Axit axetic có nhiệt độ sôi cao hơn etanol vì có khối lượng mol phân tử lớn hơn.
Số phát biểu sai
A. 3.                                   B. 5.                                 C. 4.                                   D. 2.
Câu 31: Đun nóng m gam este đơn chức X (trong phân tử chỉ chứa một loại nhóm chức) cần dùng 0,16 mol NaOH, sản phẩm hữu cơ thu được chỉ có (1,25m + 2,04) gam hỗn hợp muối. Nếu đốt cháy a mol X cần dùng 0,57 mol O2, thu được CO2 và H2O. Giá trị của a là
A. 0,09.                              B. 0,03.                            C. 0,12.                              D. 0,06.
Câu 32: Điện phân dung dịch X chứa a mol CuSO4 và 0,15 mol KCl bằng điện cực trơ, cường độ dòng điện không đổi. Sau t giây thu được 0,1 mol khí ở anot. Sau 2t giây thì tổng thể tích khí thu được ở cả hai điện cực là 4,76 lít ở đktc. Biết hiệu suất phản ứng điện phân là 100%. Giá trị a là
A. 0,1.                                B. 0,15.                            C. 0,75.                              D. 0,2.
Câu 33: Chất X có công thức phân tử C9H16O4. Khi cho X tác dụng với NaOH dư thu được một muối mà từ muối này điều chế trực tiếp được axit dùng để sản xuất tơ nilon-6,6. Số công thức cấu tạo thoả mãn X
A. 3.                                   B. 4.                                 C. 1.                                   D. 2.
Câu 34: X là một peptit mạch hở có công thức phân tử C13H24N4O6. Thực hiện các phản ứng sau (theo đúng tỉ lệ mol các chất):
  1. X + 4NaOH ® X1 + H2NCH2COONa + X2 + 2H2O
  2. X1 + 3HCl ® C5H10NO4Cl + 2NaCl
Nhận định nào sau đây đúng?
  1. X là một tetrapeptit.
  2. X2 tác dụng với dung dịch HCl theo tỉ lệ mol tương ứng 1 : 3.
  3. X1 được ứng dụng làm mì chính (bột ngọt).
  4. Trong dung dịch, X1 làm quỳ tím hóa đỏ.
Câu 35: Khi nhúng thanh Mg có khối lượng m gam vào dung dịch hỗn hợp X chứa a mol Cu(NO3)2 và b mol HCl ta có đồ thị biểu diễn sự phụ thuộc của khối lượng Mg vào thời gian phản ứng được biểu diễn như hình vẽ dưới đây:
Câu 35 Đề Thi Thử THPT Quốc Gia 2020 Môn Hóa Trường THPT Lương Thế Vinh - Hà Nội
Sau khi phản ứng xảy ra hoàn toàn rút thanh Mg ra, thu được NO là sản phẩm khử duy nhất của N+5. Tỉ  lệ a : b là
A. 1 : 8.                              B. 1 : 12.                          C. 1 : 10.                            D. 1 : 6.
Câu 36: Thực hiện phản ứng nhiệt nhôm hỗn hợp X gồm Al và Fe2O3 trong điều kiện không có không khí thu được 28,92 gam hỗn hợp Y, nghiền nhỏ, trộn đều và chia hỗn hợp Y thành hai phần. Phần một tác dụng với dung dịch NaOH dư thu được 1,008 lít H2 (đktc) và 3,36 gam chất rắn không tan. Phần hai tác dụng vừa đủ với 608 ml dung dịch HNO3 2,5M thu được 3,808 lít NO (đktc) và dung dịch Z chứa m gam hỗn hợp muối. Các phản ứng xảy ra hoàn toàn. Giá trị m gần giá trị nào nhất sau đây?
A. 101.                               B. 102.                             C. 99.                                 D. 100.
Câu 37: X, Y là hai este đều đơn chức và là đồng phân của nhau. Hóa hơi hoàn toàn 11,0 gam X thì thể tích hơi đúng bằng thể tích của 3,5 gam N2 (đo cùng điều kiện). Thủy phân hoàn toàn hỗn hợp E chứa X, Y trong môi trường axit, thu được một axit cacboxylic Z duy nhất và hỗn hợp T chứa 2 ancol. Nhận định nào sau đây là sai?
  1. Sản phẩm thu được khi cho Z thực hiện phản ứng tráng gương toàn là các chất vô cơ.
  2. X, Y, Z đều cho phản ứng tráng gương.
  3. Đun nóng T với H2SO4 đặc ở 170°C thu được hỗn hợp hai anken.
  4. Hai ancol trong T là đồng phân cấu tạo của nhau.
Câu 38: Hỗn hợp E chứa ba pepitt mạch hở được tạo bởi từ glyxin, alanin và valin, trong đó có hai peptit có cùng số nguyên tử cacbon, tổng số nguyên tử oxi của ba peptit là 10. Thủy phân hoàn toàn 23,06 gam E với 400 ml dung dịch NaOH 1M, cô cạn dung dịch sau phản ứng, lấy phần rắn đem đốt cháy cần dùng 0,87 mol O2, thu được Na2CO3 và 1,5 mol hỗn hợp T gồm CO2, H2O và N2. Phần trăm khối lượng của peptit có khối lượng phân tử nhỏ nhất là
A. 57,24%.                         B. 56,98%.                       C. 65,05%.                         D. 45,79%.
Câu 39: Hấp thụ hoàn toàn 3,36 lít CO2 (đktc) vào dung dịch chứa a mol NaOH và b mol Na2CO3, thu được dung dịch X. Chia X thành hai phần bằng nhau.
+ Cho từ từ phần một vào 140 ml dung dịch HCl 1M, thu được 2,24 lít CO2 (đktc).
+ Cho phần hai phản ứng hết với dung dịch Ba(OH)2 dư, thu được 29,55 gam kết tủa.
Tổng của (a + b) có giá trị bằng?
A. 0,25.                              B. 0,27.                            C. 0,32.                              D. 0,28.
Câu 40: Hỗn hợp X chứa hai este đều no, đơn chức, mạch hở. Hỗn hợp Y chứa hai hợp chất hữu cơ kế tiếp thuộc dãy đồng đẳng của glyxin. Đốt cháy hết m gam hỗn hợp E chứa X Y cần dùng 1,27 mol O2, thu được CO2, N2 và 19,08 gam nước. Mặt khác đun nóng m gam E với dung dịch NaOH vừa đủ, cô cạn dung dịch sau phản ứng, thu được 0,2 mol hỗn hợp Z gồm hai ancol có tỉ khối so với He bằng 12,9 và hỗn hợp T chứa ba muối. Phần trăm khối lượng của muối có khối lượng phân tử lớn nhất trong hỗn hợp T
A. 10,47%.                         B. 17,46%.                       C. 15,70%.                         D. 11,64%.

 
Đáp Án Đề Thi Thử THPT Quốc Gia 2020 Môn Hóa Trường THPT Lương Thế Vinh - Hà Nội
Đáp Án Đề Thi Thử THPT Quốc Gia 2020 Môn Hóa Trường THPT Lương Thế Vinh - Hà Nội
Đáp Án Đề Thi Thử THPT Quốc Gia 2020 Môn Hóa Trường THPT Lương Thế Vinh - Hà Nội

Dưới đây là những cuốn sách luyện thi THPT Quốc gia môn Hóa hay và bổ ích, sẽ là những người bạn đồng hành tuyệt vời cho các bạn học sinh đang luyện thi.


Đột Phá 8+: Kì Thi THPT Quốc Gia - Môn Hóa
Cuốn sách Đột Phá 8+: Kì Thi THPT Quốc Gia - Môn Hóa là sản phẩm của đội ngũ giáo viên đầy nhiệt huyết của CCBook. Sách bao gồm kiến thức 3 lớp 10, 11,12 với mong muốn hỗ trợ học sinh ôn thi THPT  đạt điểm số môn Hóa học cao nhất trong kỳ thi THPT Quốc gia năm 2019.
♦ Các kiến thức được viết theo chương/ chuyên đề. Bao gồm 3 lớp 10, 11, 12
♦ Lí thuyết trọng tâm: được trình bày chi tiết, đầy đủ các kiến thức có liên quan. Song song với mỗi phần lí thuyết đó có một ví dụ mẫu để làm rõ vấn đề.
♦ Các dạng bài tập: chia thành các dạng bài tập nhỏ, sau đó có phương pháp giải chi tiết kèm theo các ví dụ minh họa và phân tích ví dụ theo lối tư duy ngược để rèn tư duy logic cho học sinh.
♦ Sau mỗi ví dụ minh họa là các lưu ý cho học sinh khi giải bài tập ở dạng đó. Ngoài ra, các em học sinh còn được làm thêm các bài tập tự luyện ngay sau đó kèm lời giải chi tiết trong hệ thống CCtest.


Mega Luyện Đề 2019 Đỉnh Cao - 39 Đề Chinh Phục Kì Thi THPT Quốc Gia Hóa Học
Đây là một trong những cuốn sách luyện đề THPT quốc gia hóa học HOT nhất hiện nay, vậy điều gì làm nên ưu thế của cuốn sách này:
- Diện mạo bắt mắt và nổi bật, với loạt Thông điệp truyền cảm hứng và tạo động lực cho sĩ tử chinh phục kì thi THPT Quốc Gia
- Tổng hợp ôn tập kiến thức cả 3 năm lớp 10 - 11 - 12 một các khoa học giúp các em học một cách có logic từ đó các em sẽ nhớ sâu và lâu hơn.
- Tính năng bổ trợ cực hấp dẫn
♦ Video bài giảng 8+ đi kèm lời giải chi tiết (được tặng kèm miễn phí trong sách)
♦ Note: Ghi chú mọi công thức và mẹo làm bài giúp em dễ dàng tra cứu
- Tích hợp 39 đề kỉ lục - Chuẩn cấu trúc 3 năm cho em thỏa sức luyện đề - vững bước

Công Phá Bài Tập Hóa Lớp 10-11-12

Trong cuốn sách này bạn sẽ:
⇒ Thử thách bản thân với hàng loạt bài tập phân bổ đều cả 3 lớp 10-11-12, được chọn lọc kĩ càng. Cả cuốn sách được chia thành 20 chương theo từng dạng bài cụ thể và 10 chương theo từng phương pháp giải bài tập điển hình. Các bài tập trong cuốn sách đều là những bài tập điển hình và quen thuộc nhất trong các đề thi thử THPT quốc gia và chính các bài kiểm tra trên lớp của các em học sinh.
⇒ Tiếp cận các phương pháp giải Hóa học tối ưu nhất. Các phương pháp trong cuốn sách đều là các phương pháp được chọn lọc kĩ càng, đồng thời được trình bày cẩn thận và rõ ràng với lời hướng dẫn chi tiết… Cuốn sách dễ hiểu, dễ học ngay cả với những bạn mới bắt đầu tiếp xúc với Hóa học.
⇒ Ngoài các ví dụ giúp các bạn định hình dạng toán, cuốn sách còn bao hàm rất nhiều bài tập tự luyện có đáp án, giúp các bạn giải quen dạng và quen tay, nhằm tối ưu hóa thời gian khi làm các đề thi. 

Hy vọng với những đề thi thử THPT Quốc gia 2020 môn Hóa mà Newshop cung cấp các bạn có thể ôn tập, luyện thi một cách thoải mái, tiện lợi. Chúc các bạn có một kì ôn thi thật hiệu quả, gặt hái đuọce kết quả tốt.